| ID: | S2 | |
|---|---|---|
| Name: | Alanycarb | |
| Description: | Standard InChI is not able to describe the structure of this compound as given in the article or known databases. | |
| Labels: | carbamate | |
| CAS: | ||
| InChi Code: | InChI=1S/C17H25N3O4S2/c1-5-23-16(21)11-12-20(13-15-9-7-6-8-10-15)26-19(3)17(22)24-18-14(2)25-4/h6-10H,5,11-13H2,1-4H3/b18-14- |
pLD50: 48-h Honeybee toxicity as -log(LD50) [log(bee/micromol)] i
| Value | Source or prediction |
|---|---|
| 2.773 |
experimental value |
| 3 |
Tab1_Consensus: MLR consensus model (Validation set) |
| Link | Resource description |
|---|---|
| DTXSID5058195 | US EPA CompTox Dashboard |