| ID: | 28 | |
|---|---|---|
| Name: | 2-cresol | |
| Description: | ||
| Labels: | validation | |
| CAS: | 95-48-7 | |
| InChi Code: | InChI=1S/C7H8O/c1-6-4-2-3-5-7(6)8/h2-5,8H,1H3 |
pEC50: 15-minute algal toxicity as log(1/EC50) [log(1/mM)] i
| Value | Source or prediction |
|---|---|
| -0.81 |
experimental value |
| -0.502 |
Eq5: MLR with logKow - non-polar narcosis (Training set) |
| -0.754 |
Eq6: MLR with logKow and LUMO (Training set) |
| -0.783 |
Eq7: MLR with logKow, LUMO and ∆1χv (Training set) |
| -0.740 |
Eq8: MLR with logKow, LUMO and ∆1χv (Validation set) |
| -0.7029 |
Fig5: Non-linear kNN model, k = 7 (Training set) |
| -0.7727 |
Fig7: Non-linear kNN consensus model, k = 5, 6, 7 (Validation set) |
| Link | Resource description |
|---|---|
| DTXSID8021808 | US EPA CompTox Dashboard |