| ID: | 42 | |
|---|---|---|
| Name: | 3-chloroaniline | |
| Description: | ||
| Labels: | training | |
| CAS: | 108-42-9 | |
| InChi Code: | InChI=1S/C6H6ClN/c7-5-2-1-3-6(8)4-5/h1-4H,8H2 |
pEC50: 15-minute algal toxicity as log(1/EC50) [log(1/mM)] i
| Value | Source or prediction |
|---|---|
| -0.31 |
experimental value |
| -0.574 |
Eq5: MLR with logKow - non-polar narcosis (Training set) |
| -0.758 |
Eq6: MLR with logKow and LUMO (Training set) |
| -0.880 |
Eq7: MLR with logKow, LUMO and ∆1χv (Training set) |
| -0.881 |
Eq8: MLR with logKow, LUMO and ∆1χv (Training set) |
| -0.8900 |
Fig5: Non-linear kNN model, k = 7 (Training set) |
| -0.9299 |
Fig7: Non-linear kNN consensus model, k = 5, 6, 7 (Training set) |
| Link | Resource description |
|---|---|
| DTXSID0024761 | US EPA CompTox Dashboard |