| ID: | 43 | |
|---|---|---|
| Name: | benzyl methacrylate | |
| Description: | ||
| Labels: | validation | |
| CAS: | 2495-37-6 | |
| InChi Code: | InChI=1S/C11H12O2/c1-9(2)11(12)13-8-10-6-4-3-5-7-10/h3-7H,1,8H2,2H3 |
pEC50: 15-minute algal toxicity as log(1/EC50) [log(1/mM)] i
| Value | Source or prediction |
|---|---|
| -0.21 |
experimental value |
| 0.096 |
Eq5: MLR with logKow - non-polar narcosis (Training set) |
| -0.145 |
Eq6: MLR with logKow and LUMO (Training set) |
| 0.185 |
Eq7: MLR with logKow, LUMO and ∆1χv (Training set) |
| 0.358 |
Eq8: MLR with logKow, LUMO and ∆1χv (Validation set) |
| -0.5043 |
Fig5: Non-linear kNN model, k = 7 (Training set) |
| -0.5811 |
Fig7: Non-linear kNN consensus model, k = 5, 6, 7 (Validation set) |
| Link | Resource description |
|---|---|
| DTXSID0022193 | US EPA CompTox Dashboard |