| ID: | 80 | |
|---|---|---|
| Name: | 2,4-dichloro-6-nitrophenol | |
| Description: | ||
| Labels: | training | |
| CAS: | 609-89-2 | |
| InChi Code: | InChI=1S/C6H3Cl2NO3/c7-3-1-4(8)6(10)5(2-3)9(11)12/h1-2,10H |
pEC50: 15-minute algal toxicity as log(1/EC50) [log(1/mM)] i
| Value | Source or prediction |
|---|---|
| 1.5 |
experimental value |
| 0.652 |
Eq5: MLR with logKow - non-polar narcosis (Training set) |
| 0.915 |
Eq6: MLR with logKow and LUMO (Training set) |
| 1.079 |
Eq7: MLR with logKow, LUMO and ∆1χv (Training set) |
| 1.127 |
Eq8: MLR with logKow, LUMO and ∆1χv (Training set) |
| 1.1114 |
Fig5: Non-linear kNN model, k = 7 (Training set) |
| 1.0946 |
Fig7: Non-linear kNN consensus model, k = 5, 6, 7 (Training set) |
| Link | Resource description |
|---|---|
| DTXSID00209738 | US EPA CompTox Dashboard |