| ID: | A18 | |
|---|---|---|
| Name: | Indomethacin | |
| Description: | ||
| Labels: | Acid | |
| CAS: | 53-86-1 | |
| InChi Code: | InChI=1S/C19H16ClNO4/c1-11-15(10-18(22)23)16-9-14(25-2)7-8-17(16)21(11)19(24)12-3-5-13(20)6-4-12/h3-9H,10H2,1-2H3,(H,22,23) |
logPeff_pH3: Logarithmic effective membrane permeability at pH 3 [log(cm/s)]
| Value | Source or prediction |
|---|---|
| -4.67 |
experimental value |
| -5.26 |
Eq.4: QSAR model for membrane permeability of acidic compounds at pH 3 (Training set) |
logPeff_pH5: Logarithmic effective membrane permeability at pH 5 [log(cm/s)]
| Value | Source or prediction |
|---|---|
| -4.76 |
experimental value |
| -5.34 |
Eq.5: QSAR model for membrane permeability of acidic compounds at pH 5 (Training set) |
| Link | Resource description |
|---|---|
| DTXSID9020740 | US EPA CompTox Dashboard |