| ID: | A29 | |
|---|---|---|
| Name: | Sulindac | |
| Description: | ||
| Labels: | Acid | |
| CAS: | 38194-50-2 | |
| InChi Code: | InChI=1S/C20H17FO3S/c1-12-17(9-13-3-6-15(7-4-13)25(2)24)16-8-5-14(21)10-19(16)18(12)11-20(22)23/h3-10H,11H2,1-2H3,(H,22,23)/b17-9- |
logPeff_pH3: Logarithmic effective membrane permeability at pH 3 [log(cm/s)]
| Value | Source or prediction |
|---|---|
| -5.48 |
experimental value |
| -5.15 |
Eq.4: QSAR model for membrane permeability of acidic compounds at pH 3 (Training set) |
logPeff_pH5: Logarithmic effective membrane permeability at pH 5 [log(cm/s)]
| Value | Source or prediction |
|---|---|
| -6.01 |
experimental value |
| -5.25 |
Eq.5: QSAR model for membrane permeability of acidic compounds at pH 5 (Training set) |
| Link | Resource description |
|---|---|
| DTXSID4023624 | US EPA CompTox Dashboard |