| ID: | A3 | |
|---|---|---|
| Name: | Acitretin | |
| Description: | ||
| Labels: | Acid | |
| CAS: | 55079-83-9 | |
| InChi Code: | InChI=1S/C21H26O3/c1-14(8-7-9-15(2)12-21(22)23)10-11-19-16(3)13-20(24-6)18(5)17(19)4/h7-13H,1-6H3,(H,22,23)/b9-7+,11-10+,14-8+,15-12- |
logPeff_pH3: Logarithmic effective membrane permeability at pH 3 [log(cm/s)]
| Value | Source or prediction |
|---|---|
| -4.79 |
experimental value |
| -4.39 |
Eq.4: QSAR model for membrane permeability of acidic compounds at pH 3 (Training set) |
logPeff_pH5: Logarithmic effective membrane permeability at pH 5 [log(cm/s)]
| Value | Source or prediction |
|---|---|
| -4.88 |
experimental value |
| -4.56 |
Eq.5: QSAR model for membrane permeability of acidic compounds at pH 5 (Training set) |