| ID: | A36 | |
|---|---|---|
| Name: | Warfarin | |
| Description: | ||
| Labels: | Acid | |
| CAS: | 81-81-2 | |
| InChi Code: | InChI=1S/C19H16O4/c1-12(20)11-15(13-7-3-2-4-8-13)17-18(21)14-9-5-6-10-16(14)23-19(17)22/h2-10,15,21H,11H2,1H3/t15-/m1/s1 |
logPeff_pH3: Logarithmic effective membrane permeability at pH 3 [log(cm/s)]
| Value | Source or prediction |
|---|---|
| -4.55 |
experimental value |
| -4.35 |
Eq.4: QSAR model for membrane permeability of acidic compounds at pH 3 (Training set) |
logPeff_pH5: Logarithmic effective membrane permeability at pH 5 [log(cm/s)]
| Value | Source or prediction |
|---|---|
| -4.61 |
experimental value |
| -4.53 |
Eq.5: QSAR model for membrane permeability of acidic compounds at pH 5 (Training set) |
| Link | Resource description |
|---|---|
| DTXSID5023742 | US EPA CompTox Dashboard |