| ID: | A6 | |
|---|---|---|
| Name: | Chloramphenicol | |
| Description: | ||
| Labels: | Acid | |
| CAS: | 56-75-7 | |
| InChi Code: | InChI=1S/C11H12Cl2N2O5/c12-10(13)11(18)14-8(5-16)9(17)6-1-3-7(4-2-6)15(19)20/h1-4,8-10,16-17H,5H2,(H,14,18)/t8-,9-/m1/s1 |
logPeff_pH3: Logarithmic effective membrane permeability at pH 3 [log(cm/s)]
| Value | Source or prediction |
|---|---|
| -7.13 |
experimental value |
| -6.21 |
Eq.4: QSAR model for membrane permeability of acidic compounds at pH 3 (Training set) |
logPeff_pH5: Logarithmic effective membrane permeability at pH 5 [log(cm/s)]
| Value | Source or prediction |
|---|---|
| -7.05 |
experimental value |
| -6.19 |
Eq.5: QSAR model for membrane permeability of acidic compounds at pH 5 (Training set) |
| Link | Resource description |
|---|---|
| DTXSID7020265 | US EPA CompTox Dashboard |