| ID: | B31 | |
|---|---|---|
| Name: | Lamivudine | |
| Description: | ||
| Labels: | Base | |
| CAS: | 134678-17-4 | |
| InChi Code: | InChI=1S/C8H11N3O3S/c9-5-1-2-11(8(13)10-5)6-4-15-7(3-12)14-6/h1-2,6-7,12H,3-4H2,(H2,9,10,13)/t6-,7+/m0/s1 |
logPeff_pH7.4: Logarithmic effective membrane permeability at pH 7.4 [log(cm/s)]
| Value | Source or prediction |
|---|---|
| -7.2 |
experimental value |
| -6.73 |
Eq.11: QSAR model for membrane permeability of basic compounds at pH 7.4 (Validation set) |
logPeff_pH9: Logarithmic effective membrane permeability at pH 9 [log(cm/s)]
| Value | Source or prediction |
|---|---|
| -7.13 |
experimental value |
| -6.83 |
Eq.12: QSAR model for membrane permeability of basic compounds at pH 9 (Validation set) |