| ID: | B39 | |
|---|---|---|
| Name: | Nevirapine | |
| Description: | ||
| Labels: | Base | |
| CAS: | 129618-40-2 | |
| InChi Code: | InChI=1S/C15H14N4O/c1-9-6-8-17-14-12(9)18-15(20)11-3-2-7-16-13(11)19(14)10-4-5-10/h2-3,6-8,10H,4-5H2,1H3,(H,18,20) |
logPeff_pH7.4: Logarithmic effective membrane permeability at pH 7.4 [log(cm/s)]
| Value | Source or prediction |
|---|---|
| -4.91 |
experimental value |
| -4.79 |
Eq.11: QSAR model for membrane permeability of basic compounds at pH 7.4 (Training set) |
logPeff_pH9: Logarithmic effective membrane permeability at pH 9 [log(cm/s)]
| Value | Source or prediction |
|---|---|
| -4.92 |
experimental value |
| -4.95 |
Eq.12: QSAR model for membrane permeability of basic compounds at pH 9 (Training set) |
| Link | Resource description |
|---|---|
| DTXSID7031797 | US EPA CompTox Dashboard |