| ID: | B48 | |
|---|---|---|
| Name: | Procaine | |
| Description: | ||
| Labels: | Base | |
| CAS: | 59-46-1 | |
| InChi Code: | InChI=1S/C13H20N2O2/c1-3-15(4-2)9-10-17-13(16)11-5-7-12(14)8-6-11/h5-8H,3-4,9-10,14H2,1-2H3 |
logPeff_pH7.4: Logarithmic effective membrane permeability at pH 7.4 [log(cm/s)]
| Value | Source or prediction |
|---|---|
| -5.62 |
experimental value |
| -5.97 |
Eq.11: QSAR model for membrane permeability of basic compounds at pH 7.4 (Training set) |
logPeff_pH9: Logarithmic effective membrane permeability at pH 9 [log(cm/s)]
| Value | Source or prediction |
|---|---|
| -5.11 |
experimental value |
| -5.41 |
Eq.12: QSAR model for membrane permeability of basic compounds at pH 9 (Validation set) |
| Link | Resource description |
|---|---|
| DTXSID7045021 | US EPA CompTox Dashboard |