| ID: | B52 | |
|---|---|---|
| Name: | Quinine | |
| Description: | ||
| Labels: | Base | |
| CAS: | 130-95-0 | |
| InChi Code: | InChI=1S/C20H24N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3/t13-,14-,19-,20+/m0/s1 |
logPeff_pH7.4: Logarithmic effective membrane permeability at pH 7.4 [log(cm/s)]
| Value | Source or prediction |
|---|---|
| -5.35 |
experimental value |
| -5.67 |
Eq.11: QSAR model for membrane permeability of basic compounds at pH 7.4 (Training set) |
logPeff_pH9: Logarithmic effective membrane permeability at pH 9 [log(cm/s)]
| Value | Source or prediction |
|---|---|
| -4.74 |
experimental value |
| -5.1 |
Eq.12: QSAR model for membrane permeability of basic compounds at pH 9 (Training set) |
| Link | Resource description |
|---|---|
| DTXSID0044280 | US EPA CompTox Dashboard |