| ID: | B53 | |
|---|---|---|
| Name: | Scopolamine | |
| Description: | ||
| Labels: | Base | |
| CAS: | 51-34-3 | |
| InChi Code: | InChI=1S/C17H21NO4/c1-18-13-7-11(8-14(18)16-15(13)22-16)21-17(20)12(9-19)10-5-3-2-4-6-10/h2-6,11-16,19H,7-9H2,1H3/t11-,12-,13+,14-,15-,16+/m0/s1 |
logPeff_pH7.4: Logarithmic effective membrane permeability at pH 7.4 [log(cm/s)]
| Value | Source or prediction |
|---|---|
| -5.81 |
experimental value |
| -5.72 |
Eq.11: QSAR model for membrane permeability of basic compounds at pH 7.4 (Validation set) |
logPeff_pH9: Logarithmic effective membrane permeability at pH 9 [log(cm/s)]
| Value | Source or prediction |
|---|---|
| -5.77 |
experimental value |
| -5.79 |
Eq.12: QSAR model for membrane permeability of basic compounds at pH 9 (Training set) |