| ID: | B55 | |
|---|---|---|
| Name: | Zalcitabine | |
| Description: | ||
| Labels: | Base | |
| CAS: | 7481-89-2 | |
| InChi Code: | InChI=1S/C9H13N3O3/c10-7-3-4-12(9(14)11-7)8-2-1-6(5-13)15-8/h3-4,6,8,13H,1-2,5H2,(H2,10,11,14)/t6-,8+/m0/s1 |
logPeff_pH7.4: Logarithmic effective membrane permeability at pH 7.4 [log(cm/s)]
| Value | Source or prediction |
|---|---|
| -7.19 |
experimental value |
| -6.78 |
Eq.11: QSAR model for membrane permeability of basic compounds at pH 7.4 (Training set) |
logPeff_pH9: Logarithmic effective membrane permeability at pH 9 [log(cm/s)]
| Value | Source or prediction |
|---|---|
| -7.07 |
experimental value |
| -6.87 |
Eq.12: QSAR model for membrane permeability of basic compounds at pH 9 (Training set) |
| Link | Resource description |
|---|---|
| DTXSID0023747 | US EPA CompTox Dashboard |