| ID: | B60 | |
|---|---|---|
| Name: | Trazodone | |
| Description: | ||
| Labels: | Base | |
| CAS: | 19794-93-5 | |
| InChi Code: | InChI=1S/C19H22ClN5O/c20-16-5-3-6-17(15-16)23-13-11-22(12-14-23)8-4-10-25-19(26)24-9-2-1-7-18(24)21-25/h1-3,5-7,9,15H,4,8,10-14H2 |
logPeff_pH7.4: Logarithmic effective membrane permeability at pH 7.4 [log(cm/s)]
| Value | Source or prediction |
|---|---|
| -4.5 |
experimental value |
| -4.53 |
Eq.11: QSAR model for membrane permeability of basic compounds at pH 7.4 (Validation set) |
logPeff_pH9: Logarithmic effective membrane permeability at pH 9 [log(cm/s)]
| Value | Source or prediction |
|---|---|
| -4.48 |
experimental value |
| -4.61 |
Eq.12: QSAR model for membrane permeability of basic compounds at pH 9 (Training set) |
| Link | Resource description |
|---|---|
| DTXSID5045043 | US EPA CompTox Dashboard |