| ID: | 1075 | |
|---|---|---|
| Name: | 2,2',3,4,5,5',6-heptachloro-1,1'-biphenyl | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 2.2'.3.4.5.5'.6'-Heptachloro-1.1'-biphenyl (PCB 185) | |
| Labels: | ||
| CAS: | 52712-05-7 | |
| InChi Code: | InChI=1S/C12H3Cl7/c13-4-1-2-6(14)5(3-4)7-8(15)10(17)12(19)11(18)9(7)16/h1-3H |
M2.logKoc: Soil sorption coefficient as log(Koc) i
| Value | Source or prediction |
|---|---|
| 5.77 |
experimental value |
| 5.4341 |
Tab2.Model_2: logKoc (Training set) |
M5.logHLn: Biotransformation half-lives in fish
| Value | Source or prediction |
|---|---|
| 2.477492161 |
experimental value |
| 2.4953 |
Tab2.Model_5: Metab. biotransf. fish (Training set) |
| Link | Resource description |
|---|---|
| DTXSID1074175 | US EPA CompTox Dashboard |