| ID: | 1164 | |
|---|---|---|
| Name: | 4-methoxy-2-nitroaniline | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: Benzenamine. 4-methoxy-2-nitro- The representation of nitro groups was fixed | |
| Labels: | ||
| CAS: | 96-96-8 | |
| InChi Code: | InChI=1S/C7H8N2O3/c1-12-5-2-3-6(8)7(4-5)9(10)11/h2-4H,8H2,1H3 |
M5.logHLn: Biotransformation half-lives in fish
| Value | Source or prediction |
|---|---|
| -0.869174539 |
experimental value |
| -0.9876 |
Tab2.Model_5: Metab. biotransf. fish (Training set) |
| Link | Resource description |
|---|---|
| DTXSID3044750 | US EPA CompTox Dashboard |