| ID: | 266 | |
|---|---|---|
| Name: | (3S,7S,11E)-3,4,5,6,7,8,9,10-Octahydro-7,14,16-trihydroxy-3-methyl-1H-2-benzoxacyclotetradecin-1-one | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: b-Zearalenol | |
| Labels: | ||
| CAS: | 71030-11-0 | |
| InChi Code: | InChI=1S/C18H24O5/c1-12-6-5-9-14(19)8-4-2-3-7-13-10-15(20)11-16(21)17(13)18(22)23-12/h3,7,10-12,14,19-21H,2,4-6,8-9H2,1H3/b7-3+/t12-,14-/m0/s1 |
M4.logRBA: Estrogen receptor relative binding affinity as log(RBA)
| Value | Source or prediction |
|---|---|
| -0.69 |
experimental value |
| 0.3347 |
Tab2.Model_4: EDC estrogen receptor binding (Training set) |
| Link | Resource description |
|---|---|
| DTXSID8022533 | US EPA CompTox Dashboard |