| ID: | 280 | |
|---|---|---|
| Name: | 5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: Apigenin | |
| Labels: | ||
| CAS: | 520-36-5 | |
| InChi Code: | InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h1-7,16-18H |
M4.logRBA: Estrogen receptor relative binding affinity as log(RBA)
| Value | Source or prediction |
|---|---|
| -1.55 |
experimental value |
| -2.052 |
Tab2.Model_4: EDC estrogen receptor binding (Training set) |
| Link | Resource description |
|---|---|
| DTXSID6022391 | US EPA CompTox Dashboard |