| ID: | 345 | |
|---|---|---|
| Name: | 3-ethylphenol | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 3-Ethylphenol | |
| Labels: | ||
| CAS: | 620-17-7 | |
| InChi Code: | InChI=1S/C8H10O/c1-2-7-4-3-5-8(9)6-7/h3-6,9H,2H2,1H3 |
M4.logRBA: Estrogen receptor relative binding affinity as log(RBA)
| Value | Source or prediction |
|---|---|
| -3.87 |
experimental value |
| -3.9226 |
Tab2.Model_4: EDC estrogen receptor binding (Training set) |
| Link | Resource description |
|---|---|
| DTXSID0022480 | US EPA CompTox Dashboard |