| ID: | 379 | |
|---|---|---|
| Name: | methyl 2,4-dihydroxybenzoate | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: Methyl 2,4-dihydroxybenzoate | |
| Labels: | ||
| CAS: | 2150-47-2 | |
| InChi Code: | InChI=1S/C8H8O4/c1-12-8(11)6-3-2-5(9)4-7(6)10/h2-4,9-10H,1H3 |
M1.pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| 3.57 |
experimental value |
| 3.8385 |
Tab2.Model_1: P. promelas LC50 (Training set) |
M6.pLC50: Fathead minnow toxicity as log(1/LC50) [-log(mmol/L)]
| Value | Source or prediction |
|---|---|
| 0.64 |
experimental value |
| 0.8148 |
Tab2.Model_6: Esters P. promelas LC50 (Training set) |
| Link | Resource description |
|---|---|
| DTXSID2022177 | US EPA CompTox Dashboard |