| ID: | 431 | |
|---|---|---|
| Name: | prop-2-enoic acid | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 2-propenoic acid | |
| Labels: | ||
| CAS: | 79-10-7 | |
| InChi Code: | InChI=1S/C3H4O2/c1-2-3(4)5/h2H,1H2,(H,4,5) |
M3.GHLI: Global half-life index i
| Value | Source or prediction |
|---|---|
| -1.84173 |
experimental value |
| -1.8281 |
Tab2.Model_3: Global half-life index (Training set) |
| Link | Resource description |
|---|---|
| DTXSID0039229 | US EPA CompTox Dashboard |