| ID: | 617 | |
|---|---|---|
| Name: | 2,6-dinitro-4-(propan-2-yl)-N,N-dipropylaniline | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: Isopropalin The representation of nitro groups was fixed | |
| Labels: | ||
| CAS: | 33820-53-0 | |
| InChi Code: | InChI=1S/C15H23N3O4/c1-5-7-16(8-6-2)15-13(17(19)20)9-12(11(3)4)10-14(15)18(21)22/h9-11H,5-8H2,1-4H3 |
M2.logKoc: Soil sorption coefficient as log(Koc) i
| Value | Source or prediction |
|---|---|
| 4 |
experimental value |
| 3.7063 |
Tab2.Model_2: logKoc (Training set) |
M3.GHLI: Global half-life index i
| Value | Source or prediction |
|---|---|
| 0.22223 |
experimental value |
| -0.4162 |
Tab2.Model_3: Global half-life index (Training set) |
| Link | Resource description |
|---|---|
| DTXSID8024157 | US EPA CompTox Dashboard |