| ID: | 682 | |
|---|---|---|
| Name: | 1,2-dimethoxybenzene | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 1,2-Dimethoxybenzene | |
| Labels: | ||
| CAS: | 91-16-7 | |
| InChi Code: | InChI=1S/C8H10O2/c1-9-7-5-3-4-6-8(7)10-2/h3-6H,1-2H3 |
M2.logKoc: Soil sorption coefficient as log(Koc) i
| Value | Source or prediction |
|---|---|
| 2.03 |
experimental value |
| 2.6361 |
Tab2.Model_2: logKoc (Training set) |
| Link | Resource description |
|---|---|
| DTXSID7047065 | US EPA CompTox Dashboard |