| ID: | 694 | |
|---|---|---|
| Name: | ethyl benzoate | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: Ethyl benzoate | |
| Labels: | ||
| CAS: | 93-89-0 | |
| InChi Code: | InChI=1S/C9H10O2/c1-2-11-9(10)8-6-4-3-5-7-8/h3-7H,2H2,1H3 |
M2.logKoc: Soil sorption coefficient as log(Koc) i
| Value | Source or prediction |
|---|---|
| 2.3 |
experimental value |
| 1.7777 |
Tab2.Model_2: logKoc (Training set) |
| Link | Resource description |
|---|---|
| DTXSID3038696 | US EPA CompTox Dashboard |