| ID: | 696 | |
|---|---|---|
| Name: | ethyl 4-methylbenzoate | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: Ethyl 4-methylbenzoate | |
| Labels: | ||
| CAS: | 94-08-6 | |
| InChi Code: | InChI=1S/C10H12O2/c1-3-12-10(11)9-6-4-8(2)5-7-9/h4-7H,3H2,1-2H3 |
M2.logKoc: Soil sorption coefficient as log(Koc) i
| Value | Source or prediction |
|---|---|
| 2.59 |
experimental value |
| 1.9966 |
Tab2.Model_2: logKoc (Training set) |
| Link | Resource description |
|---|---|
| DTXSID5048211 | US EPA CompTox Dashboard |