| ID: | 742 | |
|---|---|---|
| Name: | 3-methylaniline | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 3-Methylaniline | |
| Labels: | ||
| CAS: | 108-44-1 | |
| InChi Code: | InChI=1S/C7H9N/c1-6-3-2-4-7(8)5-6/h2-5H,8H2,1H3 |
M2.logKoc: Soil sorption coefficient as log(Koc) i
| Value | Source or prediction |
|---|---|
| 1.65 |
experimental value |
| 2.0908 |
Tab2.Model_2: logKoc (Training set) |
| Link | Resource description |
|---|---|
| DTXSID1026792 | US EPA CompTox Dashboard |