| ID: | 765 | |
|---|---|---|
| Name: | pyridazine-3,6-diol | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: Maleic hydrazine | |
| Labels: | ||
| CAS: | 123-33-1 | |
| InChi Code: | InChI=1S/C4H4N2O2/c7-3-1-2-4(8)6-5-3/h1-2H,(H,5,7)(H,6,8) |
M2.logKoc: Soil sorption coefficient as log(Koc) i
| Value | Source or prediction |
|---|---|
| 0.45 |
experimental value |
| 0.378 |
Tab2.Model_2: logKoc (Training set) |
| Link | Resource description |
|---|---|
| DTXSID9020792 | US EPA CompTox Dashboard |