| ID: | 766 | |
|---|---|---|
| Name: | dibromo(chloro)methane | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: Chlorodibromomethane | |
| Labels: | ||
| CAS: | 124-48-1 | |
| InChi Code: | InChI=1S/CHBr2Cl/c2-1(3)4/h1H |
M2.logKoc: Soil sorption coefficient as log(Koc) i
| Value | Source or prediction |
|---|---|
| 1.92 |
experimental value |
| 2.3126 |
Tab2.Model_2: logKoc (Training set) |
| Link | Resource description |
|---|---|
| DTXSID1020300 | US EPA CompTox Dashboard |