| ID: | 844 | |
|---|---|---|
| Name: | 4-methylbenzamide | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 4-Methylbenzamide | |
| Labels: | ||
| CAS: | 619-55-6 | |
| InChi Code: | InChI=1S/C8H9NO/c1-6-2-4-7(5-3-6)8(9)10/h2-5H,1H3,(H2,9,10) |
M2.logKoc: Soil sorption coefficient as log(Koc) i
| Value | Source or prediction |
|---|---|
| 1.78 |
experimental value |
| 1.7084 |
Tab2.Model_2: logKoc (Training set) |
| Link | Resource description |
|---|---|
| DTXSID2060705 | US EPA CompTox Dashboard |