| ID: | 853 | |
|---|---|---|
| Name: | 3-nitrobenzene-1-carboximidic acid | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 3-Nitrobenzamide The representation of nitro groups was fixed | |
| Labels: | ||
| CAS: | 645-09-0 | |
| InChi Code: | InChI=1S/C7H6N2O3/c8-7(10)5-2-1-3-6(4-5)9(11)12/h1-4H,(H2,8,10) |
M2.logKoc: Soil sorption coefficient as log(Koc) i
| Value | Source or prediction |
|---|---|
| 1.95 |
experimental value |
| 1.7307 |
Tab2.Model_2: logKoc (Training set) |