| ID: | 880 | |
|---|---|---|
| Name: | N,N-dimethyl-2,2-diphenylacetamide | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: Diphenamid | |
| Labels: | ||
| CAS: | 957-51-7 | |
| InChi Code: | InChI=1S/C16H17NO/c1-17(2)16(18)15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,15H,1-2H3 |
M2.logKoc: Soil sorption coefficient as log(Koc) i
| Value | Source or prediction |
|---|---|
| 2.06 |
experimental value |
| 3.0962 |
Tab2.Model_2: logKoc (Training set) |
| Link | Resource description |
|---|---|
| DTXSID8024072 | US EPA CompTox Dashboard |