| ID: | 923 | |
|---|---|---|
| Name: | 2-chloro-1,1'-biphenyl | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 2-Chlorobiphenyl | |
| Labels: | ||
| CAS: | 2051-60-7 | |
| InChi Code: | InChI=1S/C12H9Cl/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H |
M2.logKoc: Soil sorption coefficient as log(Koc) i
| Value | Source or prediction |
|---|---|
| 3.52 |
experimental value |
| 3.8475 |
Tab2.Model_2: logKoc (Training set) |
| Link | Resource description |
|---|---|
| DTXSID6040298 | US EPA CompTox Dashboard |