| ID: | 989 | |
|---|---|---|
| Name: | 2,2'-dichloro-1,1'-biphenyl | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 2,2'-Dichlorobiphenyl | |
| Labels: | ||
| CAS: | 13029-08-8 | |
| InChi Code: | InChI=1S/C12H8Cl2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H |
M2.logKoc: Soil sorption coefficient as log(Koc) i
| Value | Source or prediction |
|---|---|
| 3.92 |
experimental value |
| 4.116 |
Tab2.Model_2: logKoc (Training set) |
| Link | Resource description |
|---|---|
| DTXSID4044533 | US EPA CompTox Dashboard |