Oja, M.; Maran, U. Quantitative structure-permeability relationships at various pH values for neutral and amphoteric drugs and drug-like compounds. SAR QSAR Environ. Res. 2016, 27, 813-832.
Compound
| ID: | N10 | |
|---|---|---|
| Name: | Oxcarbazepine | |
| Description: | ||
| Labels: | Neutral | |
| CAS: | 28721-07-5 | |
| InChi Code: | InChI=1S/C15H12N2O2/c16-15(19)17-12-7-3-1-5-10(12)9-14(18)11-6-2-4-8-13(11)17/h1-8H,9H2,(H2,16,19) |
Properties
LogPeff_average: Average logarithmic effective membrane permeability for pH range 3 to 9 of neutral compounds [log(cm/s)]
| Value | Source or prediction |
|---|---|
| -5.57 |
experimental value |
| -5.6 |
Eq.9: QSAR model for average membrane permeability of neutral compounds (Validation set) |
Links to External Resources
| Link | Resource description |
|---|---|
| DTXSID0045703 | US EPA CompTox Dashboard |