| ID: | 240 | |
|---|---|---|
| Name: | 17alpha-Estradiol | |
| Description: | Name was changed from Estradiol to 17alpha-Estradiol | |
| Labels: | ||
| CAS: | 57-91-0 | |
| InChi Code: | InChI=1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17-,18+/m1/s1 |
MlogP: Measured octanol/water partition coefficient as logP
| Value | Source or prediction |
|---|---|
| 3.86 |
experimental value |
logSobs: Aqueous solubility as logS [mol/L]
| Value | Source or prediction |
|---|---|
| -5.03 |
experimental value |
| -5.23 |
Eq.1: General solubility equation (Test set to verify GSE) |
| Link | Resource description |
|---|---|
| DTXSID8022377 | US EPA CompTox Dashboard |