| ID: | 858 | |
|---|---|---|
| Name: | N-Ethyl-N-nitrosourea | |
| Description: | Name was changed from 1-Nitroso-1-ethylurea to N-Ethyl-N-nitrosourea | |
| Labels: | ||
| CAS: | 759-73-9 | |
| InChi Code: | InChI=1S/C3H7N3O2/c1-2-6(5-8)3(4)7/h2H2,1H3,(H2,4,7) |
MlogP: Measured octanol/water partition coefficient as logP
| Value | Source or prediction |
|---|---|
| 0.23 |
experimental value |
logSobs: Aqueous solubility as logS [mol/L]
| Value | Source or prediction |
|---|---|
| -0.96 |
experimental value |
| -0.6 |
Eq.1: General solubility equation (Test set to verify GSE) |
| Link | Resource description |
|---|---|
| DTXSID8020593 | US EPA CompTox Dashboard |