Compound
| ID: | 46 | |
|---|---|---|
| Name: | 2,3-Dihydroxybenzoic acid | |
| Description: | In the article descriptor values for Toluene and 2,3-Dihydroxybenzoic acid were swapped | |
| Labels: | ||
| CAS: | 303-38-8 | |
| InChi Code: | InChI=1S/C7H6O4/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3,8-9H,(H,10,11) |
Properties
logEC50: Bioluminescent Shk1 aquatic toxicity as logEC50 [log(mmol/L)] i
| Value | Source or prediction |
|---|---|
| 0 |
experimental value |
| 0.46 |
Table.8: Final model (Training set) |
Links to External Resources
| Link | Resource description |
|---|---|
| DTXSID70858712 | US EPA CompTox Dashboard |