| ID: | N9 | |
|---|---|---|
| Name: | 1,1,2,2-tetrachloroethane | |
| Description: | ||
| Labels: | Non-polar | |
| CAS: | 79-34-5 | |
| InChi Code: | InChI=1S/C2H2Cl4/c3-1(4)2(5)6/h1-2H |
logLC50: 96-h Fathead minnow toxicity as logLC50 [log(mol/L)]
| Value | Source or prediction |
|---|---|
| -3.91 |
Veith, G. D.; Call, D. J.; Brooke, L. T. Structure–Toxicity Relationships for the Fathead Minnow, Pimephales promelas: Narcotic Industrial Chemicals. Canadian Journal of Fisheries and Aquatic Sciences 1983, 40, 743–748. https://doi.org/10.1139/f83-096 |
| -3.38 |
QSAR1: Non-polar narcosis model (Training set) |
| -3.68 |
QSAR3: Narcosis model (Training set) |