Tulp, I.; Tamm, T.; Karelson, G.; Dobchev, D.; Martin, D.; Tämm, K.; Savchenko, D.; Jänes, J.; Härk, E.; Kreegipuu, A.; Karelson, M. QSAR for abiotic degradation in air. Q13-22a-0034. Molcode Ltd., 2010.
Compound
| ID: | 100 | |
|---|---|---|
| Name: | 3,3',4,4',5,5'-hexachlorobiphenyl | |
| Description: | Structure (mol-file) matches with CAS but not with the name | |
| Labels: | ||
| CAS: | 26601-64-9 | |
| InChi Code: | InChI=1S/C12H4Cl6/c13-7-1-5(2-8(14)11(7)17)6-3-9(15)12(18)10(16)4-6/h1-4H |
Properties
logT(0.5): Degradation half-life in air [log(h)]
| Value | Source or prediction |
|---|---|
| 3.74 |
experimental value |
| 3.06 |
QSAR: Model for degradation half-life (Training set) |