| ID: | 776 | |
|---|---|---|
| Name: | 3,4-dichlorophenyl urea | |
| Description: | ||
| Labels: | ||
| CAS: | 2327-02-8 | |
| InChi Code: | InChI=1S/C7H6Cl2N2O/c8-5-2-1-4(3-6(5)9)11-7(10)12/h1-3H,(H3,10,11,12) |
NOEC_class: reproductive toxicity class of No-Observed-Effect Concentration for earthworms i
| Value | Source or prediction |
|---|---|
| nontoxic |
experimental value |
| nontoxic |
modelA: Model A (Training (under sampled)) |
| nontoxic |
modelA: Model A (Training (all)) |
| nontoxic |
modelB: Model B (Training (under sampled)) |
| nontoxic |
modelB: Model B (Training (all)) |
| nontoxic |
model_AB: model_AB (Training (under sampled)) |
| nontoxic |
model_AB: model_AB (Training (all)) |
NOEC: reproductive toxicity of No-Observed-Effect Concentration for earthworms as mg/kg in soil [mg/kg] i
| Value | Source or prediction |
|---|---|
| 128.5 |
experimental value |