| ID: | N1056 | |
|---|---|---|
| Name: | methylcyclohexane, 4-cyano-1-butylpyridinium bis(trifluoromethylsulfonyl)imide | |
| Description: | methylcyclohexane [4-CNBPy]+[(Tf)2N]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C10H13N2.C7H14.C2F6NO4S2/c1-2-3-6-12-7-4-10(9-11)5-8-12;1-7-5-3-2-4-6-7;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h4-5,7-8H,2-3,6H2,1H3;7H,2-6H2,1H3;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 1.726 |
experimental value |
| 2.103020616023739 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 1.878488917492745 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |