| ID: | N1146 | |
|---|---|---|
| Name: | 2,2,4-trimethylpentane, 1-hexyl-3-methylimidazolium tetracyanoborate | |
| Description: | 2,2,4-trimethylpentane [MHIm]+[B(CN)4]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C10H19N2.C8H18.C4BN4/c1-3-4-5-6-7-12-9-8-11(2)10-12;1-7(2)6-8(3,4)5;6-1-5(2-7,3-8)4-9/h8-10H,3-7H2,1-2H3;7H,6H2,1-5H3;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 1.777 |
experimental value |
| 1.620177726950074 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 1.874883294138315 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |