| ID: | N1221 | |
|---|---|---|
| Name: | tetrachloromethane, 1,3-dimethoxyimidazolium bis(trifluoromethylsulfonyl)imide | |
| Description: | tetrachloromethane [(Meo)2Im]+[Tf2N]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C5H9N2O2.C2F6NO4S2.CCl4/c1-8-6-3-4-7(5-6)9-2;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8;2-1(3,4)5/h3-5H,1-2H3;;/q+1;-1; |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 1.819409078272111 |
experimental value |
| 1.926310806101139 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 2.121470494615598 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |