| ID: | N1461 | |
|---|---|---|
| Name: | tert-butyl methyl ether, 1,2-dimethyl-3-ethylimidazolium bis(trifluoromethylsulfonyl)imide | |
| Description: | tert-butyl methyl ether [M2EIm]+[Tf2N]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C7H13N2.C5H12O.C2F6NO4S2/c1-4-9-6-5-8(3)7(9)2;1-5(2,3)6-4;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h5-6H,4H2,1-3H3;1-4H3;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 1.958 |
experimental value |
| 1.92373762186119 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 2.049814113420011 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |