| ID: | N151 | |
|---|---|---|
| Name: | cyclopentane, 1-hydroxypropyl-3-methylimidazolium dicyanamide | |
| Description: | cyclopentane [PrOHMIm]+[N(CN)2]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C7H13N2O.C5H10.C2N3/c1-8-4-5-9(7-8)3-2-6-10;1-2-4-5-3-1;3-1-5-2-4/h4-5,7,10H,2-3,6H2,1H3;1-5H2;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 0.6875289612146344 |
experimental value |
| 1.593873887701138 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 0.7459620977811894 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |