| ID: | N186 | |
|---|---|---|
| Name: | 3-methylpentane, 1,3-dimethoxyimidazolium bis(trifluoromethylsulfonyl)imide | |
| Description: | 3-methylpentane [(Meo)2Im]+[Tf2N]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C6H14.C5H9N2O2.C2F6NO4S2/c1-4-6(3)5-2;1-8-6-3-4-7(5-6)9-2;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h6H,4-5H2,1-3H3;3-5H,1-2H3;/q;+1;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 0.8065953729331481 |
experimental value |
| 0.7334094648240943 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 0.8224258585316432 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |