| ID: | N1871 | |
|---|---|---|
| Name: | cycloheptane, 1-benzyl-1-methylpyrrolidinium bis(trifluoromethylsulfonyl)imide | |
| Description: | cycloheptane [BzMPyrr]+[Tf2N]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C12H18N.C7H14.C2F6NO4S2/c1-13(9-5-6-10-13)11-12-7-3-2-4-8-12;1-2-4-6-7-5-3-1;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h2-4,7-8H,5-6,9-11H2,1H3;1-7H2;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 2.183 |
experimental value |
| 2.070324101972806 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 2.268629986815475 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |